C21H22Cl2N2O3S — CID 16834478
2-[3-[(3,4-dichlorophenyl)methylsulfonyl]indol-1-yl]-N,N-diethylacetamide (PubChem CID 16834478) has the molecular formula C21H22Cl2N2O3S and a molecular weight of 453.39 g/mol. Its IUPAC name is 2-[3-[(3,4-dichlorophenyl)methylsulfonyl]indol-1-yl]-N,N-diethylacetamide.
| Compound Name | 2-[3-[(3,4-dichlorophenyl)methylsulfonyl]indol-1-yl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 16834478 |
| Molecular Formula | C21H22Cl2N2O3S |
| Molecular Weight | 453.39 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 2-[3-[(3,4-dichlorophenyl)methylsulfonyl]indol-1-yl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)Cn1cc(S(=O)(=O)Cc2ccc(Cl)c(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C21H22Cl2N2O3S/c1-3-24(4-2)21(26)13-25-12-20(16-7-5-6-8-19(16)25)29(27,28)14-15-9-10-17(22)18(23)11-15/h5-12H,3-4,13-14H2,1-2H3 |
| InChIKey | PQVWNFREQJMSQE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.39 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |