C26H24ClFN2O3S — CID 30292178
N-benzyl-2-[3-[(2-chloro-6-fluorophenyl)methylsulfonyl]indol-1-yl]-N-ethylacetamide (PubChem CID 30292178) has the molecular formula C26H24ClFN2O3S and a molecular weight of 499.01 g/mol. Its IUPAC name is N-benzyl-2-[3-[(2-chloro-6-fluorophenyl)methylsulfonyl]indol-1-yl]-N-ethylacetamide.
| Compound Name | N-benzyl-2-[3-[(2-chloro-6-fluorophenyl)methylsulfonyl]indol-1-yl]-N-ethylacetamide |
|---|---|
| PubChem CID | 30292178 |
| Molecular Formula | C26H24ClFN2O3S |
| Molecular Weight | 499.01 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | N-benzyl-2-[3-[(2-chloro-6-fluorophenyl)methylsulfonyl]indol-1-yl]-N-ethylacetamide |
| SMILES | CCN(Cc1ccccc1)C(=O)Cn1cc(S(=O)(=O)Cc2c(F)cccc2Cl)c2ccccc21 |
| InChI | InChI=1S/C26H24ClFN2O3S/c1-2-29(15-19-9-4-3-5-10-19)26(31)17-30-16-25(20-11-6-7-14-24(20)30)34(32,33)18-21-22(27)12-8-13-23(21)28/h3-14,16H,2,15,17-18H2,1H3 |
| InChIKey | ZXDHFPMILTZKER-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.01 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |