C27H27FN2O3S — CID 30559684
N-benzyl-2-[3-[(2-fluorophenyl)methylsulfonyl]indol-1-yl]-N-propan-2-ylacetamide (PubChem CID 30559684) has the molecular formula C27H27FN2O3S and a molecular weight of 478.59 g/mol. Its IUPAC name is N-benzyl-2-[3-[(2-fluorophenyl)methylsulfonyl]indol-1-yl]-N-propan-2-ylacetamide.
| Compound Name | N-benzyl-2-[3-[(2-fluorophenyl)methylsulfonyl]indol-1-yl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 30559684 |
| Molecular Formula | C27H27FN2O3S |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | N-benzyl-2-[3-[(2-fluorophenyl)methylsulfonyl]indol-1-yl]-N-propan-2-ylacetamide |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)Cn1cc(S(=O)(=O)Cc2ccccc2F)c2ccccc21 |
| InChI | InChI=1S/C27H27FN2O3S/c1-20(2)30(16-21-10-4-3-5-11-21)27(31)18-29-17-26(23-13-7-9-15-25(23)29)34(32,33)19-22-12-6-8-14-24(22)28/h3-15,17,20H,16,18-19H2,1-2H3 |
| InChIKey | BJHJZDPGEQSHRJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |