C31H27FN2O3S — CID 30560042
N,N-dibenzyl-2-[3-[(3-fluorophenyl)methylsulfonyl]indol-1-yl]acetamide (PubChem CID 30560042) has the molecular formula C31H27FN2O3S and a molecular weight of 526.63 g/mol. Its IUPAC name is N,N-dibenzyl-2-[3-[(3-fluorophenyl)methylsulfonyl]indol-1-yl]acetamide.
| Compound Name | N,N-dibenzyl-2-[3-[(3-fluorophenyl)methylsulfonyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 30560042 |
| Molecular Formula | C31H27FN2O3S |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | N,N-dibenzyl-2-[3-[(3-fluorophenyl)methylsulfonyl]indol-1-yl]acetamide |
| SMILES | O=C(Cn1cc(S(=O)(=O)Cc2cccc(F)c2)c2ccccc21)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C31H27FN2O3S/c32-27-15-9-14-26(18-27)23-38(36,37)30-21-33(29-17-8-7-16-28(29)30)22-31(35)34(19-24-10-3-1-4-11-24)20-25-12-5-2-6-13-25/h1-18,21H,19-20,22-23H2 |
| InChIKey | NQKJOXLXVLTPTR-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |