C27H27FN2O3S — CID 30560337
N-(4-butylphenyl)-2-[3-[(3-fluorophenyl)methylsulfonyl]indol-1-yl]acetamide (PubChem CID 30560337) has the molecular formula C27H27FN2O3S and a molecular weight of 478.59 g/mol. Its IUPAC name is N-(4-butylphenyl)-2-[3-[(3-fluorophenyl)methylsulfonyl]indol-1-yl]acetamide.
| Compound Name | N-(4-butylphenyl)-2-[3-[(3-fluorophenyl)methylsulfonyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 30560337 |
| Molecular Formula | C27H27FN2O3S |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | N-(4-butylphenyl)-2-[3-[(3-fluorophenyl)methylsulfonyl]indol-1-yl]acetamide |
| SMILES | CCCCc1ccc(NC(=O)Cn2cc(S(=O)(=O)Cc3cccc(F)c3)c3ccccc32)cc1 |
| InChI | InChI=1S/C27H27FN2O3S/c1-2-3-7-20-12-14-23(15-13-20)29-27(31)18-30-17-26(24-10-4-5-11-25(24)30)34(32,33)19-21-8-6-9-22(28)16-21/h4-6,8-17H,2-3,7,18-19H2,1H3,(H,29,31) |
| InChIKey | XDBXEFRYFBCCET-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |