C25H21FN2O4S — CID 30292492
N-(4-acetylphenyl)-2-[3-[(4-fluorophenyl)methylsulfonyl]indol-1-yl]acetamide (PubChem CID 30292492) has the molecular formula C25H21FN2O4S and a molecular weight of 464.52 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-[3-[(4-fluorophenyl)methylsulfonyl]indol-1-yl]acetamide.
| Compound Name | N-(4-acetylphenyl)-2-[3-[(4-fluorophenyl)methylsulfonyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 30292492 |
| Molecular Formula | C25H21FN2O4S |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | N-(4-acetylphenyl)-2-[3-[(4-fluorophenyl)methylsulfonyl]indol-1-yl]acetamide |
| SMILES | CC(=O)c1ccc(NC(=O)Cn2cc(S(=O)(=O)Cc3ccc(F)cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C25H21FN2O4S/c1-17(29)19-8-12-21(13-9-19)27-25(30)15-28-14-24(22-4-2-3-5-23(22)28)33(31,32)16-18-6-10-20(26)11-7-18/h2-14H,15-16H2,1H3,(H,27,30) |
| InChIKey | FJFLCMCWEKCTLS-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |