C24H23N3O5S2 — CID 30559600
2-[3-[(4-methylphenyl)methylsulfonyl]indol-1-yl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 30559600) has the molecular formula C24H23N3O5S2 and a molecular weight of 497.60 g/mol. Its IUPAC name is 2-[3-[(4-methylphenyl)methylsulfonyl]indol-1-yl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[3-[(4-methylphenyl)methylsulfonyl]indol-1-yl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 30559600 |
| Molecular Formula | C24H23N3O5S2 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | 2-[3-[(4-methylphenyl)methylsulfonyl]indol-1-yl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | Cc1ccc(CS(=O)(=O)c2cn(CC(=O)Nc3ccc(S(N)(=O)=O)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C24H23N3O5S2/c1-17-6-8-18(9-7-17)16-33(29,30)23-14-27(22-5-3-2-4-21(22)23)15-24(28)26-19-10-12-20(13-11-19)34(25,31)32/h2-14H,15-16H2,1H3,(H,26,28)(H2,25,31,32) |
| InChIKey | JJIOJNFKMVCWJB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 128.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |