C25H23ClN2O3S — CID 30292020
2-[3-[(4-chlorophenyl)methylsulfonyl]indol-1-yl]-N-(4-ethylphenyl)acetamide (PubChem CID 30292020) has the molecular formula C25H23ClN2O3S and a molecular weight of 466.99 g/mol. Its IUPAC name is 2-[3-[(4-chlorophenyl)methylsulfonyl]indol-1-yl]-N-(4-ethylphenyl)acetamide.
| Compound Name | 2-[3-[(4-chlorophenyl)methylsulfonyl]indol-1-yl]-N-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 30292020 |
| Molecular Formula | C25H23ClN2O3S |
| Molecular Weight | 466.99 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 2-[3-[(4-chlorophenyl)methylsulfonyl]indol-1-yl]-N-(4-ethylphenyl)acetamide |
| SMILES | CCc1ccc(NC(=O)Cn2cc(S(=O)(=O)Cc3ccc(Cl)cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C25H23ClN2O3S/c1-2-18-9-13-21(14-10-18)27-25(29)16-28-15-24(22-5-3-4-6-23(22)28)32(30,31)17-19-7-11-20(26)12-8-19/h3-15H,2,16-17H2,1H3,(H,27,29) |
| InChIKey | RXCHSXTYQNRDQC-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.99 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |