C29H24ClN3O3S — CID 43958485
N-(4-anilinophenyl)-2-[3-[(4-chlorophenyl)methylsulfonyl]indol-1-yl]acetamide (PubChem CID 43958485) has the molecular formula C29H24ClN3O3S and a molecular weight of 530.05 g/mol. Its IUPAC name is N-(4-anilinophenyl)-2-[3-[(4-chlorophenyl)methylsulfonyl]indol-1-yl]acetamide.
| Compound Name | N-(4-anilinophenyl)-2-[3-[(4-chlorophenyl)methylsulfonyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 43958485 |
| Molecular Formula | C29H24ClN3O3S |
| Molecular Weight | 530.05 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | N-(4-anilinophenyl)-2-[3-[(4-chlorophenyl)methylsulfonyl]indol-1-yl]acetamide |
| SMILES | O=C(Cn1cc(S(=O)(=O)Cc2ccc(Cl)cc2)c2ccccc21)Nc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C29H24ClN3O3S/c30-22-12-10-21(11-13-22)20-37(35,36)28-18-33(27-9-5-4-8-26(27)28)19-29(34)32-25-16-14-24(15-17-25)31-23-6-2-1-3-7-23/h1-18,31H,19-20H2,(H,32,34) |
| InChIKey | XCPVUFBPHSSXJL-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.05 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |