C23H18Cl2N2O3S — CID 30558816
2-(3-benzylsulfonylindol-1-yl)-N-(3,4-dichlorophenyl)acetamide (PubChem CID 30558816) has the molecular formula C23H18Cl2N2O3S and a molecular weight of 473.38 g/mol. Its IUPAC name is 2-(3-benzylsulfonylindol-1-yl)-N-(3,4-dichlorophenyl)acetamide.
| Compound Name | 2-(3-benzylsulfonylindol-1-yl)-N-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 30558816 |
| Molecular Formula | C23H18Cl2N2O3S |
| Molecular Weight | 473.38 g/mol |
| Exact Mass | 472.04 |
| IUPAC Name | 2-(3-benzylsulfonylindol-1-yl)-N-(3,4-dichlorophenyl)acetamide |
| SMILES | O=C(Cn1cc(S(=O)(=O)Cc2ccccc2)c2ccccc21)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H18Cl2N2O3S/c24-19-11-10-17(12-20(19)25)26-23(28)14-27-13-22(18-8-4-5-9-21(18)27)31(29,30)15-16-6-2-1-3-7-16/h1-13H,14-15H2,(H,26,28) |
| InChIKey | RRQMFLPUCPYZRL-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.38 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |