C25H23BrN2O3S — CID 30559630
N-(4-bromo-3-methylphenyl)-2-[3-[(4-methylphenyl)methylsulfonyl]indol-1-yl]acetamide (PubChem CID 30559630) has the molecular formula C25H23BrN2O3S and a molecular weight of 511.44 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-2-[3-[(4-methylphenyl)methylsulfonyl]indol-1-yl]acetamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-2-[3-[(4-methylphenyl)methylsulfonyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 30559630 |
| Molecular Formula | C25H23BrN2O3S |
| Molecular Weight | 511.44 g/mol |
| Exact Mass | 510.06 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-2-[3-[(4-methylphenyl)methylsulfonyl]indol-1-yl]acetamide |
| SMILES | Cc1ccc(CS(=O)(=O)c2cn(CC(=O)Nc3ccc(Br)c(C)c3)c3ccccc23)cc1 |
| InChI | InChI=1S/C25H23BrN2O3S/c1-17-7-9-19(10-8-17)16-32(30,31)24-14-28(23-6-4-3-5-21(23)24)15-25(29)27-20-11-12-22(26)18(2)13-20/h3-14H,15-16H2,1-2H3,(H,27,29) |
| InChIKey | APAHRHBOHZQAFI-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.44 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |