C25H24N2O3S — CID 30292624
2-[3-[(2,5-dimethylphenyl)methylsulfonyl]indol-1-yl]-N-phenylacetamide (PubChem CID 30292624) has the molecular formula C25H24N2O3S and a molecular weight of 432.55 g/mol. Its IUPAC name is 2-[3-[(2,5-dimethylphenyl)methylsulfonyl]indol-1-yl]-N-phenylacetamide.
| Compound Name | 2-[3-[(2,5-dimethylphenyl)methylsulfonyl]indol-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 30292624 |
| Molecular Formula | C25H24N2O3S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 2-[3-[(2,5-dimethylphenyl)methylsulfonyl]indol-1-yl]-N-phenylacetamide |
| SMILES | Cc1ccc(C)c(CS(=O)(=O)c2cn(CC(=O)Nc3ccccc3)c3ccccc23)c1 |
| InChI | InChI=1S/C25H24N2O3S/c1-18-12-13-19(2)20(14-18)17-31(29,30)24-15-27(23-11-7-6-10-22(23)24)16-25(28)26-21-8-4-3-5-9-21/h3-15H,16-17H2,1-2H3,(H,26,28) |
| InChIKey | HNXIFLGUYPDSKB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |