C27H32N2O3S — CID 30292673
N-[2-(cyclohexen-1-yl)ethyl]-2-[3-[(2,5-dimethylphenyl)methylsulfonyl]indol-1-yl]acetamide (PubChem CID 30292673) has the molecular formula C27H32N2O3S and a molecular weight of 464.63 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[3-[(2,5-dimethylphenyl)methylsulfonyl]indol-1-yl]acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[3-[(2,5-dimethylphenyl)methylsulfonyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 30292673 |
| Molecular Formula | C27H32N2O3S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[3-[(2,5-dimethylphenyl)methylsulfonyl]indol-1-yl]acetamide |
| SMILES | Cc1ccc(C)c(CS(=O)(=O)c2cn(CC(=O)NCCC3=CCCCC3)c3ccccc23)c1 |
| InChI | InChI=1S/C27H32N2O3S/c1-20-12-13-21(2)23(16-20)19-33(31,32)26-17-29(25-11-7-6-10-24(25)26)18-27(30)28-15-14-22-8-4-3-5-9-22/h6-8,10-13,16-17H,3-5,9,14-15,18-19H2,1-2H3,(H,28,30) |
| InChIKey | WAFWIPRBCGHBRP-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|