C25H23FN2O3S — CID 30559089
N-[(4-fluorophenyl)methyl]-2-[3-[(2-methylphenyl)methylsulfonyl]indol-1-yl]acetamide (PubChem CID 30559089) has the molecular formula C25H23FN2O3S and a molecular weight of 450.54 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-[3-[(2-methylphenyl)methylsulfonyl]indol-1-yl]acetamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-[3-[(2-methylphenyl)methylsulfonyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 30559089 |
| Molecular Formula | C25H23FN2O3S |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-[3-[(2-methylphenyl)methylsulfonyl]indol-1-yl]acetamide |
| SMILES | Cc1ccccc1CS(=O)(=O)c1cn(CC(=O)NCc2ccc(F)cc2)c2ccccc12 |
| InChI | InChI=1S/C25H23FN2O3S/c1-18-6-2-3-7-20(18)17-32(30,31)24-15-28(23-9-5-4-8-22(23)24)16-25(29)27-14-19-10-12-21(26)13-11-19/h2-13,15H,14,16-17H2,1H3,(H,27,29) |
| InChIKey | NPZSZVKQDHRREE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |