C22H19FN2O3S2 — CID 30560690
2-[3-[(4-fluorophenyl)methylsulfonyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 30560690) has the molecular formula C22H19FN2O3S2 and a molecular weight of 442.54 g/mol. Its IUPAC name is 2-[3-[(4-fluorophenyl)methylsulfonyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[3-[(4-fluorophenyl)methylsulfonyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 30560690 |
| Molecular Formula | C22H19FN2O3S2 |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 2-[3-[(4-fluorophenyl)methylsulfonyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(Cn1cc(S(=O)(=O)Cc2ccc(F)cc2)c2ccccc21)NCc1cccs1 |
| InChI | InChI=1S/C22H19FN2O3S2/c23-17-9-7-16(8-10-17)15-30(27,28)21-13-25(20-6-2-1-5-19(20)21)14-22(26)24-12-18-4-3-11-29-18/h1-11,13H,12,14-15H2,(H,24,26) |
| InChIKey | GWSSDHKKGWKFAI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |