C22H17FN2O2S — CID 1095465
2-[3-(2-fluorobenzoyl)indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 1095465) has the molecular formula C22H17FN2O2S and a molecular weight of 392.46 g/mol. Its IUPAC name is 2-[3-(2-fluorobenzoyl)indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[3-(2-fluorobenzoyl)indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 1095465 |
| Molecular Formula | C22H17FN2O2S |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 2-[3-(2-fluorobenzoyl)indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(Cn1cc(C(=O)c2ccccc2F)c2ccccc21)NCc1cccs1 |
| InChI | InChI=1S/C22H17FN2O2S/c23-19-9-3-1-8-17(19)22(27)18-13-25(20-10-4-2-7-16(18)20)14-21(26)24-12-15-6-5-11-28-15/h1-11,13H,12,14H2,(H,24,26) |
| InChIKey | PRXBKGUJXQYTER-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |