C14H15FN2OS — CID 3156882
2-fluoro-N-[2-(thiophen-2-ylmethylamino)ethyl]benzamide (PubChem CID 3156882) has the molecular formula C14H15FN2OS and a molecular weight of 278.35 g/mol. Its IUPAC name is 2-fluoro-N-[2-(thiophen-2-ylmethylamino)ethyl]benzamide.
| Compound Name | 2-fluoro-N-[2-(thiophen-2-ylmethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 3156882 |
| Molecular Formula | C14H15FN2OS |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-fluoro-N-[2-(thiophen-2-ylmethylamino)ethyl]benzamide |
| SMILES | O=C(NCCNCc1cccs1)c1ccccc1F |
| InChI | InChI=1S/C14H15FN2OS/c15-13-6-2-1-5-12(13)14(18)17-8-7-16-10-11-4-3-9-19-11/h1-6,9,16H,7-8,10H2,(H,17,18) |
| InChIKey | OUMQYPTTXWLDEZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|