C13H11F2NOS — CID 62649314
2,3-difluoro-N-(2-thiophen-2-ylethyl)benzamide (PubChem CID 62649314) has the molecular formula C13H11F2NOS and a molecular weight of 267.30 g/mol. Its IUPAC name is 2,3-difluoro-N-(2-thiophen-2-ylethyl)benzamide.
| Compound Name | 2,3-difluoro-N-(2-thiophen-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 62649314 |
| Molecular Formula | C13H11F2NOS |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 2,3-difluoro-N-(2-thiophen-2-ylethyl)benzamide |
| SMILES | O=C(NCCc1cccs1)c1cccc(F)c1F |
| InChI | InChI=1S/C13H11F2NOS/c14-11-5-1-4-10(12(11)15)13(17)16-7-6-9-3-2-8-18-9/h1-5,8H,6-7H2,(H,16,17) |
| InChIKey | UOINKNFXUMLFFU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |