C17H15FN2O2S — CID 43831713
8-fluoro-1-methyl-4-oxo-N-(2-thiophen-2-ylethyl)quinoline-3-carboxamide (PubChem CID 43831713) has the molecular formula C17H15FN2O2S and a molecular weight of 330.38 g/mol. Its IUPAC name is 8-fluoro-1-methyl-4-oxo-N-(2-thiophen-2-ylethyl)quinoline-3-carboxamide.
| Compound Name | 8-fluoro-1-methyl-4-oxo-N-(2-thiophen-2-ylethyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 43831713 |
| Molecular Formula | C17H15FN2O2S |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 8-fluoro-1-methyl-4-oxo-N-(2-thiophen-2-ylethyl)quinoline-3-carboxamide |
| SMILES | Cn1cc(C(=O)NCCc2cccs2)c(=O)c2cccc(F)c21 |
| InChI | InChI=1S/C17H15FN2O2S/c1-20-10-13(16(21)12-5-2-6-14(18)15(12)20)17(22)19-8-7-11-4-3-9-23-11/h2-6,9-10H,7-8H2,1H3,(H,19,22) |
| InChIKey | AEMDKKYYXBSIED-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |