C18H17ClN2O2S — CID 39851344
6-chloro-1-ethyl-4-oxo-N-(2-thiophen-2-ylethyl)quinoline-3-carboxamide (PubChem CID 39851344) has the molecular formula C18H17ClN2O2S and a molecular weight of 360.87 g/mol. Its IUPAC name is 6-chloro-1-ethyl-4-oxo-N-(2-thiophen-2-ylethyl)quinoline-3-carboxamide.
| Compound Name | 6-chloro-1-ethyl-4-oxo-N-(2-thiophen-2-ylethyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 39851344 |
| Molecular Formula | C18H17ClN2O2S |
| Molecular Weight | 360.87 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 6-chloro-1-ethyl-4-oxo-N-(2-thiophen-2-ylethyl)quinoline-3-carboxamide |
| SMILES | CCn1cc(C(=O)NCCc2cccs2)c(=O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C18H17ClN2O2S/c1-2-21-11-15(17(22)14-10-12(19)5-6-16(14)21)18(23)20-8-7-13-4-3-9-24-13/h3-6,9-11H,2,7-8H2,1H3,(H,20,23) |
| InChIKey | LHNAYVZZBGMWND-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.87 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |