C19H23ClN2O2 — CID 30132192
6-chloro-N-cycloheptyl-1-ethyl-4-oxoquinoline-3-carboxamide (PubChem CID 30132192) has the molecular formula C19H23ClN2O2 and a molecular weight of 346.86 g/mol. Its IUPAC name is 6-chloro-N-cycloheptyl-1-ethyl-4-oxoquinoline-3-carboxamide.
| Compound Name | 6-chloro-N-cycloheptyl-1-ethyl-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 30132192 |
| Molecular Formula | C19H23ClN2O2 |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 6-chloro-N-cycloheptyl-1-ethyl-4-oxoquinoline-3-carboxamide |
| SMILES | CCn1cc(C(=O)NC2CCCCCC2)c(=O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C19H23ClN2O2/c1-2-22-12-16(18(23)15-11-13(20)9-10-17(15)22)19(24)21-14-7-5-3-4-6-8-14/h9-12,14H,2-8H2,1H3,(H,21,24) |
| InChIKey | NDEWVDLGZOINNE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |