C20H27ClN2O — CID 110497686
5-chloro-N-cyclooctyl-1-ethyl-3-methylindole-2-carboxamide (PubChem CID 110497686) has the molecular formula C20H27ClN2O and a molecular weight of 346.90 g/mol. Its IUPAC name is 5-chloro-N-cyclooctyl-1-ethyl-3-methylindole-2-carboxamide.
| Compound Name | 5-chloro-N-cyclooctyl-1-ethyl-3-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 110497686 |
| Molecular Formula | C20H27ClN2O |
| Molecular Weight | 346.90 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 5-chloro-N-cyclooctyl-1-ethyl-3-methylindole-2-carboxamide |
| SMILES | CCn1c(C(=O)NC2CCCCCCC2)c(C)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C20H27ClN2O/c1-3-23-18-12-11-15(21)13-17(18)14(2)19(23)20(24)22-16-9-7-5-4-6-8-10-16/h11-13,16H,3-10H2,1-2H3,(H,22,24) |
| InChIKey | MPGFDRXTYZEENT-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.90 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|