C19H15Cl2F3N2O — CID 110502078
5-chloro-N-[4-chloro-3-(trifluoromethyl)phenyl]-1-ethyl-3-methylindole-2-carboxamide (PubChem CID 110502078) has the molecular formula C19H15Cl2F3N2O and a molecular weight of 415.24 g/mol. Its IUPAC name is 5-chloro-N-[4-chloro-3-(trifluoromethyl)phenyl]-1-ethyl-3-methylindole-2-carboxamide.
| Compound Name | 5-chloro-N-[4-chloro-3-(trifluoromethyl)phenyl]-1-ethyl-3-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 110502078 |
| Molecular Formula | C19H15Cl2F3N2O |
| Molecular Weight | 415.24 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | 5-chloro-N-[4-chloro-3-(trifluoromethyl)phenyl]-1-ethyl-3-methylindole-2-carboxamide |
| SMILES | CCn1c(C(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)c(C)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C19H15Cl2F3N2O/c1-3-26-16-7-4-11(20)8-13(16)10(2)17(26)18(27)25-12-5-6-15(21)14(9-12)19(22,23)24/h4-9H,3H2,1-2H3,(H,25,27) |
| InChIKey | WPICUXXSHCZAHT-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.24 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|