C20H30ClN3O — CID 110497733
5-chloro-N-[4-(diethylamino)butyl]-1-ethyl-3-methylindole-2-carboxamide (PubChem CID 110497733) has the molecular formula C20H30ClN3O and a molecular weight of 363.93 g/mol. Its IUPAC name is 5-chloro-N-[4-(diethylamino)butyl]-1-ethyl-3-methylindole-2-carboxamide.
| Compound Name | 5-chloro-N-[4-(diethylamino)butyl]-1-ethyl-3-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 110497733 |
| Molecular Formula | C20H30ClN3O |
| Molecular Weight | 363.93 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 5-chloro-N-[4-(diethylamino)butyl]-1-ethyl-3-methylindole-2-carboxamide |
| SMILES | CCN(CC)CCCCNC(=O)c1c(C)c2cc(Cl)ccc2n1CC |
| InChI | InChI=1S/C20H30ClN3O/c1-5-23(6-2)13-9-8-12-22-20(25)19-15(4)17-14-16(21)10-11-18(17)24(19)7-3/h10-11,14H,5-9,12-13H2,1-4H3,(H,22,25) |
| InChIKey | VOBLVXMZGFDRAE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.93 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|