C20H25ClN2O — CID 110497737
5-chloro-N-[2-(cyclohexen-1-yl)ethyl]-1-ethyl-3-methylindole-2-carboxamide (PubChem CID 110497737) has the molecular formula C20H25ClN2O and a molecular weight of 344.89 g/mol. Its IUPAC name is 5-chloro-N-[2-(cyclohexen-1-yl)ethyl]-1-ethyl-3-methylindole-2-carboxamide.
| Compound Name | 5-chloro-N-[2-(cyclohexen-1-yl)ethyl]-1-ethyl-3-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 110497737 |
| Molecular Formula | C20H25ClN2O |
| Molecular Weight | 344.89 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 5-chloro-N-[2-(cyclohexen-1-yl)ethyl]-1-ethyl-3-methylindole-2-carboxamide |
| SMILES | CCn1c(C(=O)NCCC2=CCCCC2)c(C)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C20H25ClN2O/c1-3-23-18-10-9-16(21)13-17(18)14(2)19(23)20(24)22-12-11-15-7-5-4-6-8-15/h7,9-10,13H,3-6,8,11-12H2,1-2H3,(H,22,24) |
| InChIKey | QWPTZVRWHMKIGQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.89 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|