C22H30N2O — CID 110497534
N-[2-(cyclohexen-1-yl)ethyl]-1,5-diethyl-3-methylindole-2-carboxamide (PubChem CID 110497534) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-1,5-diethyl-3-methylindole-2-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-1,5-diethyl-3-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 110497534 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-1,5-diethyl-3-methylindole-2-carboxamide |
| SMILES | CCc1ccc2c(c1)c(C)c(C(=O)NCCC1=CCCCC1)n2CC |
| InChI | InChI=1S/C22H30N2O/c1-4-17-11-12-20-19(15-17)16(3)21(24(20)5-2)22(25)23-14-13-18-9-7-6-8-10-18/h9,11-12,15H,4-8,10,13-14H2,1-3H3,(H,23,25) |
| InChIKey | FFPJDKDVUGWRQK-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|