C21H22N2O3 — CID 110501763
2-[(1,5-diethyl-3-methylindole-2-carbonyl)amino]benzoic acid (PubChem CID 110501763) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-[(1,5-diethyl-3-methylindole-2-carbonyl)amino]benzoic acid.
| Compound Name | 2-[(1,5-diethyl-3-methylindole-2-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 110501763 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 2-[(1,5-diethyl-3-methylindole-2-carbonyl)amino]benzoic acid |
| SMILES | CCc1ccc2c(c1)c(C)c(C(=O)Nc1ccccc1C(=O)O)n2CC |
| InChI | InChI=1S/C21H22N2O3/c1-4-14-10-11-18-16(12-14)13(3)19(23(18)5-2)20(24)22-17-9-7-6-8-15(17)21(25)26/h6-12H,4-5H2,1-3H3,(H,22,24)(H,25,26) |
| InChIKey | WSXXDSDKJMRMOH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|