C23H26N2O3 — CID 110501627
ethyl 4-[(1,5-diethyl-3-methylindole-2-carbonyl)amino]benzoate (PubChem CID 110501627) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is ethyl 4-[(1,5-diethyl-3-methylindole-2-carbonyl)amino]benzoate.
| Compound Name | ethyl 4-[(1,5-diethyl-3-methylindole-2-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 110501627 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | ethyl 4-[(1,5-diethyl-3-methylindole-2-carbonyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2c(C)c3cc(CC)ccc3n2CC)cc1 |
| InChI | InChI=1S/C23H26N2O3/c1-5-16-8-13-20-19(14-16)15(4)21(25(20)6-2)22(26)24-18-11-9-17(10-12-18)23(27)28-7-3/h8-14H,5-7H2,1-4H3,(H,24,26) |
| InChIKey | GVPXOWFVBMOJFD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|