C25H26N4O3S — CID 110501633
1,5-diethyl-3-methyl-N-[4-(pyridin-2-ylsulfamoyl)phenyl]indole-2-carboxamide (PubChem CID 110501633) has the molecular formula C25H26N4O3S and a molecular weight of 462.58 g/mol. Its IUPAC name is 1,5-diethyl-3-methyl-N-[4-(pyridin-2-ylsulfamoyl)phenyl]indole-2-carboxamide.
| Compound Name | 1,5-diethyl-3-methyl-N-[4-(pyridin-2-ylsulfamoyl)phenyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 110501633 |
| Molecular Formula | C25H26N4O3S |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 1,5-diethyl-3-methyl-N-[4-(pyridin-2-ylsulfamoyl)phenyl]indole-2-carboxamide |
| SMILES | CCc1ccc2c(c1)c(C)c(C(=O)Nc1ccc(S(=O)(=O)Nc3ccccn3)cc1)n2CC |
| InChI | InChI=1S/C25H26N4O3S/c1-4-18-9-14-22-21(16-18)17(3)24(29(22)5-2)25(30)27-19-10-12-20(13-11-19)33(31,32)28-23-8-6-7-15-26-23/h6-16H,4-5H2,1-3H3,(H,26,28)(H,27,30) |
| InChIKey | UUNFYPVLORIREW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|