C20H21BrN2O — CID 110501716
N-(4-bromophenyl)-1,5-diethyl-3-methylindole-2-carboxamide (PubChem CID 110501716) has the molecular formula C20H21BrN2O and a molecular weight of 385.31 g/mol. Its IUPAC name is N-(4-bromophenyl)-1,5-diethyl-3-methylindole-2-carboxamide.
| Compound Name | N-(4-bromophenyl)-1,5-diethyl-3-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 110501716 |
| Molecular Formula | C20H21BrN2O |
| Molecular Weight | 385.31 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | N-(4-bromophenyl)-1,5-diethyl-3-methylindole-2-carboxamide |
| SMILES | CCc1ccc2c(c1)c(C)c(C(=O)Nc1ccc(Br)cc1)n2CC |
| InChI | InChI=1S/C20H21BrN2O/c1-4-14-6-11-18-17(12-14)13(3)19(23(18)5-2)20(24)22-16-9-7-15(21)8-10-16/h6-12H,4-5H2,1-3H3,(H,22,24) |
| InChIKey | VZCIPAHHHKSCAB-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.31 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|