C21H23ClN2O — CID 110501629
N-(4-chloro-2-methylphenyl)-1,5-diethyl-3-methylindole-2-carboxamide (PubChem CID 110501629) has the molecular formula C21H23ClN2O and a molecular weight of 354.88 g/mol. Its IUPAC name is N-(4-chloro-2-methylphenyl)-1,5-diethyl-3-methylindole-2-carboxamide.
| Compound Name | N-(4-chloro-2-methylphenyl)-1,5-diethyl-3-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 110501629 |
| Molecular Formula | C21H23ClN2O |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | N-(4-chloro-2-methylphenyl)-1,5-diethyl-3-methylindole-2-carboxamide |
| SMILES | CCc1ccc2c(c1)c(C)c(C(=O)Nc1ccc(Cl)cc1C)n2CC |
| InChI | InChI=1S/C21H23ClN2O/c1-5-15-7-10-19-17(12-15)14(4)20(24(19)6-2)21(25)23-18-9-8-16(22)11-13(18)3/h7-12H,5-6H2,1-4H3,(H,23,25) |
| InChIKey | RAEGEMZSMRYKPX-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|