C17H15Cl2N3O — CID 110502209
5-chloro-N-(2-chloro-3-pyridinyl)-1-ethyl-3-methylindole-2-carboxamide (PubChem CID 110502209) has the molecular formula C17H15Cl2N3O and a molecular weight of 348.23 g/mol. Its IUPAC name is 5-chloro-N-(2-chloro-3-pyridinyl)-1-ethyl-3-methylindole-2-carboxamide.
| Compound Name | 5-chloro-N-(2-chloro-3-pyridinyl)-1-ethyl-3-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 110502209 |
| Molecular Formula | C17H15Cl2N3O |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 5-chloro-N-(2-chloro-3-pyridinyl)-1-ethyl-3-methylindole-2-carboxamide |
| SMILES | CCn1c(C(=O)Nc2cccnc2Cl)c(C)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C17H15Cl2N3O/c1-3-22-14-7-6-11(18)9-12(14)10(2)15(22)17(23)21-13-5-4-8-20-16(13)19/h4-9H,3H2,1-2H3,(H,21,23) |
| InChIKey | XRGRTJZDZMCMPK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|