C17H21ClN2O3 — CID 110497722
2-[(5-chloro-1-ethyl-3-methylindole-2-carbonyl)amino]pentanoic acid (PubChem CID 110497722) has the molecular formula C17H21ClN2O3 and a molecular weight of 336.82 g/mol. Its IUPAC name is 2-[(5-chloro-1-ethyl-3-methylindole-2-carbonyl)amino]pentanoic acid.
| Compound Name | 2-[(5-chloro-1-ethyl-3-methylindole-2-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 110497722 |
| Molecular Formula | C17H21ClN2O3 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 2-[(5-chloro-1-ethyl-3-methylindole-2-carbonyl)amino]pentanoic acid |
| SMILES | CCCC(NC(=O)c1c(C)c2cc(Cl)ccc2n1CC)C(=O)O |
| InChI | InChI=1S/C17H21ClN2O3/c1-4-6-13(17(22)23)19-16(21)15-10(3)12-9-11(18)7-8-14(12)20(15)5-2/h7-9,13H,4-6H2,1-3H3,(H,19,21)(H,22,23) |
| InChIKey | MGUMISZDXIEECU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|