C17H21N3O4 — CID 110497420
5-amino-2-[(1-ethyl-3-methylindole-2-carbonyl)amino]-5-oxopentanoic acid (PubChem CID 110497420) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is 5-amino-2-[(1-ethyl-3-methylindole-2-carbonyl)amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[(1-ethyl-3-methylindole-2-carbonyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 110497420 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 5-amino-2-[(1-ethyl-3-methylindole-2-carbonyl)amino]-5-oxopentanoic acid |
| SMILES | CCn1c(C(=O)NC(CCC(N)=O)C(=O)O)c(C)c2ccccc21 |
| InChI | InChI=1S/C17H21N3O4/c1-3-20-13-7-5-4-6-11(13)10(2)15(20)16(22)19-12(17(23)24)8-9-14(18)21/h4-7,12H,3,8-9H2,1-2H3,(H2,18,21)(H,19,22)(H,23,24) |
| InChIKey | BJUHNWJRWWTBMC-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|