C20H30N2O — CID 110497414
1-ethyl-3-methyl-N-(2,4,4-trimethylpentan-2-yl)indole-2-carboxamide (PubChem CID 110497414) has the molecular formula C20H30N2O and a molecular weight of 314.47 g/mol. Its IUPAC name is 1-ethyl-3-methyl-N-(2,4,4-trimethylpentan-2-yl)indole-2-carboxamide.
| Compound Name | 1-ethyl-3-methyl-N-(2,4,4-trimethylpentan-2-yl)indole-2-carboxamide |
|---|---|
| PubChem CID | 110497414 |
| Molecular Formula | C20H30N2O |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | 1-ethyl-3-methyl-N-(2,4,4-trimethylpentan-2-yl)indole-2-carboxamide |
| SMILES | CCn1c(C(=O)NC(C)(C)CC(C)(C)C)c(C)c2ccccc21 |
| InChI | InChI=1S/C20H30N2O/c1-8-22-16-12-10-9-11-15(16)14(2)17(22)18(23)21-20(6,7)13-19(3,4)5/h9-12H,8,13H2,1-7H3,(H,21,23) |
| InChIKey | XCJANKJONCHEPD-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|