C20H22N2O — CID 110501475
N-(2,6-dimethylphenyl)-1-ethyl-3-methylindole-2-carboxamide (PubChem CID 110501475) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-1-ethyl-3-methylindole-2-carboxamide.
| Compound Name | N-(2,6-dimethylphenyl)-1-ethyl-3-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 110501475 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | N-(2,6-dimethylphenyl)-1-ethyl-3-methylindole-2-carboxamide |
| SMILES | CCn1c(C(=O)Nc2c(C)cccc2C)c(C)c2ccccc21 |
| InChI | InChI=1S/C20H22N2O/c1-5-22-17-12-7-6-11-16(17)15(4)19(22)20(23)21-18-13(2)9-8-10-14(18)3/h6-12H,5H2,1-4H3,(H,21,23) |
| InChIKey | VRSLSTZPQZHANL-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|