C20H20Cl2N2O — CID 110501258
1-butyl-N-(2,6-dichlorophenyl)-3-methylindole-2-carboxamide (PubChem CID 110501258) has the molecular formula C20H20Cl2N2O and a molecular weight of 375.30 g/mol. Its IUPAC name is 1-butyl-N-(2,6-dichlorophenyl)-3-methylindole-2-carboxamide.
| Compound Name | 1-butyl-N-(2,6-dichlorophenyl)-3-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 110501258 |
| Molecular Formula | C20H20Cl2N2O |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 1-butyl-N-(2,6-dichlorophenyl)-3-methylindole-2-carboxamide |
| SMILES | CCCCn1c(C(=O)Nc2c(Cl)cccc2Cl)c(C)c2ccccc21 |
| InChI | InChI=1S/C20H20Cl2N2O/c1-3-4-12-24-17-11-6-5-8-14(17)13(2)19(24)20(25)23-18-15(21)9-7-10-16(18)22/h5-11H,3-4,12H2,1-2H3,(H,23,25) |
| InChIKey | SAPZBEZQCBNELT-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|