C16H19N5O — CID 110501382
1-butyl-3-methyl-N-(1H-1,2,4-triazol-5-yl)indole-2-carboxamide (PubChem CID 110501382) has the molecular formula C16H19N5O and a molecular weight of 297.36 g/mol. Its IUPAC name is 1-butyl-3-methyl-N-(1H-1,2,4-triazol-5-yl)indole-2-carboxamide.
| Compound Name | 1-butyl-3-methyl-N-(1H-1,2,4-triazol-5-yl)indole-2-carboxamide |
|---|---|
| PubChem CID | 110501382 |
| Molecular Formula | C16H19N5O |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 1-butyl-3-methyl-N-(1H-1,2,4-triazol-5-yl)indole-2-carboxamide |
| SMILES | CCCCn1c(C(=O)Nc2ncn[nH]2)c(C)c2ccccc21 |
| InChI | InChI=1S/C16H19N5O/c1-3-4-9-21-13-8-6-5-7-12(13)11(2)14(21)15(22)19-16-17-10-18-20-16/h5-8,10H,3-4,9H2,1-2H3,(H2,17,18,19,20,22) |
| InChIKey | QKPJLWFLQVDLSB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|