C20H26N4OS — CID 110503514
1-butyl-3-methyl-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]indole-2-carboxamide (PubChem CID 110503514) has the molecular formula C20H26N4OS and a molecular weight of 370.52 g/mol. Its IUPAC name is 1-butyl-3-methyl-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]indole-2-carboxamide.
| Compound Name | 1-butyl-3-methyl-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]indole-2-carboxamide |
|---|---|
| PubChem CID | 110503514 |
| Molecular Formula | C20H26N4OS |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 1-butyl-3-methyl-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]indole-2-carboxamide |
| SMILES | CCCCn1c(C(=O)Nc2nnc(CC(C)C)s2)c(C)c2ccccc21 |
| InChI | InChI=1S/C20H26N4OS/c1-5-6-11-24-16-10-8-7-9-15(16)14(4)18(24)19(25)21-20-23-22-17(26-20)12-13(2)3/h7-10,13H,5-6,11-12H2,1-4H3,(H,21,23,25) |
| InChIKey | HWBYCDPOYGOODQ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|