C21H21N3OS2 — CID 110503516
1-butyl-3-methyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)indole-2-carboxamide (PubChem CID 110503516) has the molecular formula C21H21N3OS2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 1-butyl-3-methyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)indole-2-carboxamide.
| Compound Name | 1-butyl-3-methyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)indole-2-carboxamide |
|---|---|
| PubChem CID | 110503516 |
| Molecular Formula | C21H21N3OS2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 1-butyl-3-methyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)indole-2-carboxamide |
| SMILES | CCCCn1c(C(=O)Nc2nc(-c3cccs3)cs2)c(C)c2ccccc21 |
| InChI | InChI=1S/C21H21N3OS2/c1-3-4-11-24-17-9-6-5-8-15(17)14(2)19(24)20(25)23-21-22-16(13-27-21)18-10-7-12-26-18/h5-10,12-13H,3-4,11H2,1-2H3,(H,22,23,25) |
| InChIKey | FSPSPGXPMGWXBF-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|