C23H26N2O3 — CID 110501209
ethyl 4-[(1-butyl-3-methylindole-2-carbonyl)amino]benzoate (PubChem CID 110501209) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is ethyl 4-[(1-butyl-3-methylindole-2-carbonyl)amino]benzoate.
| Compound Name | ethyl 4-[(1-butyl-3-methylindole-2-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 110501209 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | ethyl 4-[(1-butyl-3-methylindole-2-carbonyl)amino]benzoate |
| SMILES | CCCCn1c(C(=O)Nc2ccc(C(=O)OCC)cc2)c(C)c2ccccc21 |
| InChI | InChI=1S/C23H26N2O3/c1-4-6-15-25-20-10-8-7-9-19(20)16(3)21(25)22(26)24-18-13-11-17(12-14-18)23(27)28-5-2/h7-14H,4-6,15H2,1-3H3,(H,24,26) |
| InChIKey | WMFFLZMSDWARLQ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|