C23H28N2O3S — CID 110503547
ethyl 2-[(1-butyl-3-methylindole-2-carbonyl)amino]-5-ethylthiophene-3-carboxylate (PubChem CID 110503547) has the molecular formula C23H28N2O3S and a molecular weight of 412.56 g/mol. Its IUPAC name is ethyl 2-[(1-butyl-3-methylindole-2-carbonyl)amino]-5-ethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(1-butyl-3-methylindole-2-carbonyl)amino]-5-ethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 110503547 |
| Molecular Formula | C23H28N2O3S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | ethyl 2-[(1-butyl-3-methylindole-2-carbonyl)amino]-5-ethylthiophene-3-carboxylate |
| SMILES | CCCCn1c(C(=O)Nc2sc(CC)cc2C(=O)OCC)c(C)c2ccccc21 |
| InChI | InChI=1S/C23H28N2O3S/c1-5-8-13-25-19-12-10-9-11-17(19)15(4)20(25)21(26)24-22-18(23(27)28-7-3)14-16(6-2)29-22/h9-12,14H,5-8,13H2,1-4H3,(H,24,26) |
| InChIKey | HSVRPSPCUKOKJP-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|