C23H28N2O4S — CID 110504013
ethyl 2-[(5-ethoxy-1-ethyl-3-methylindole-2-carbonyl)amino]-5-ethylthiophene-3-carboxylate (PubChem CID 110504013) has the molecular formula C23H28N2O4S and a molecular weight of 428.55 g/mol. Its IUPAC name is ethyl 2-[(5-ethoxy-1-ethyl-3-methylindole-2-carbonyl)amino]-5-ethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(5-ethoxy-1-ethyl-3-methylindole-2-carbonyl)amino]-5-ethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 110504013 |
| Molecular Formula | C23H28N2O4S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | ethyl 2-[(5-ethoxy-1-ethyl-3-methylindole-2-carbonyl)amino]-5-ethylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(CC)sc1NC(=O)c1c(C)c2cc(OCC)ccc2n1CC |
| InChI | InChI=1S/C23H28N2O4S/c1-6-16-13-18(23(27)29-9-4)22(30-16)24-21(26)20-14(5)17-12-15(28-8-3)10-11-19(17)25(20)7-2/h10-13H,6-9H2,1-5H3,(H,24,26) |
| InChIKey | TXGSMSRZZRLRAY-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|