C23H26N2O6S — CID 110503972
dimethyl 5-[(5-ethoxy-1-ethyl-3-methylindole-2-carbonyl)amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 110503972) has the molecular formula C23H26N2O6S and a molecular weight of 458.54 g/mol. Its IUPAC name is dimethyl 5-[(5-ethoxy-1-ethyl-3-methylindole-2-carbonyl)amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 5-[(5-ethoxy-1-ethyl-3-methylindole-2-carbonyl)amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 110503972 |
| Molecular Formula | C23H26N2O6S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | dimethyl 5-[(5-ethoxy-1-ethyl-3-methylindole-2-carbonyl)amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOc1ccc2c(c1)c(C)c(C(=O)Nc1sc(C(=O)OC)c(C)c1C(=O)OC)n2CC |
| InChI | InChI=1S/C23H26N2O6S/c1-7-25-16-10-9-14(31-8-2)11-15(16)12(3)18(25)20(26)24-21-17(22(27)29-5)13(4)19(32-21)23(28)30-6/h9-11H,7-8H2,1-6H3,(H,24,26) |
| InChIKey | YDNZZVXTWOHWDE-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|