C20H20ClFN2O2 — CID 110502258
N-(3-chloro-4-fluorophenyl)-5-ethoxy-1-ethyl-3-methylindole-2-carboxamide (PubChem CID 110502258) has the molecular formula C20H20ClFN2O2 and a molecular weight of 374.84 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-5-ethoxy-1-ethyl-3-methylindole-2-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-5-ethoxy-1-ethyl-3-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 110502258 |
| Molecular Formula | C20H20ClFN2O2 |
| Molecular Weight | 374.84 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-5-ethoxy-1-ethyl-3-methylindole-2-carboxamide |
| SMILES | CCOc1ccc2c(c1)c(C)c(C(=O)Nc1ccc(F)c(Cl)c1)n2CC |
| InChI | InChI=1S/C20H20ClFN2O2/c1-4-24-18-9-7-14(26-5-2)11-15(18)12(3)19(24)20(25)23-13-6-8-17(22)16(21)10-13/h6-11H,4-5H2,1-3H3,(H,23,25) |
| InChIKey | RPIGGATYYGLVPX-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.84 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|