C18H21N3O2S — CID 110504039
5-ethoxy-1-ethyl-3-methyl-N-(5-methyl-1,3-thiazol-2-yl)indole-2-carboxamide (PubChem CID 110504039) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is 5-ethoxy-1-ethyl-3-methyl-N-(5-methyl-1,3-thiazol-2-yl)indole-2-carboxamide.
| Compound Name | 5-ethoxy-1-ethyl-3-methyl-N-(5-methyl-1,3-thiazol-2-yl)indole-2-carboxamide |
|---|---|
| PubChem CID | 110504039 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 5-ethoxy-1-ethyl-3-methyl-N-(5-methyl-1,3-thiazol-2-yl)indole-2-carboxamide |
| SMILES | CCOc1ccc2c(c1)c(C)c(C(=O)Nc1ncc(C)s1)n2CC |
| InChI | InChI=1S/C18H21N3O2S/c1-5-21-15-8-7-13(23-6-2)9-14(15)12(4)16(21)17(22)20-18-19-10-11(3)24-18/h7-10H,5-6H2,1-4H3,(H,19,20,22) |
| InChIKey | DDSBEBBKSAURTJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|