C18H24N2O5 — CID 110497830
2-[(5-ethoxy-1-ethyl-3-methylindole-2-carbonyl)amino]-3-hydroxybutanoic acid (PubChem CID 110497830) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-[(5-ethoxy-1-ethyl-3-methylindole-2-carbonyl)amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[(5-ethoxy-1-ethyl-3-methylindole-2-carbonyl)amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 110497830 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2-[(5-ethoxy-1-ethyl-3-methylindole-2-carbonyl)amino]-3-hydroxybutanoic acid |
| SMILES | CCOc1ccc2c(c1)c(C)c(C(=O)NC(C(=O)O)C(C)O)n2CC |
| InChI | InChI=1S/C18H24N2O5/c1-5-20-14-8-7-12(25-6-2)9-13(14)10(3)16(20)17(22)19-15(11(4)21)18(23)24/h7-9,11,15,21H,5-6H2,1-4H3,(H,19,22)(H,23,24) |
| InChIKey | MDODVLFRMOAPTF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|