C17H20N4O2S — CID 110503961
5-ethoxy-1-ethyl-3-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)indole-2-carboxamide (PubChem CID 110503961) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is 5-ethoxy-1-ethyl-3-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)indole-2-carboxamide.
| Compound Name | 5-ethoxy-1-ethyl-3-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)indole-2-carboxamide |
|---|---|
| PubChem CID | 110503961 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 5-ethoxy-1-ethyl-3-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)indole-2-carboxamide |
| SMILES | CCOc1ccc2c(c1)c(C)c(C(=O)Nc1nnc(C)s1)n2CC |
| InChI | InChI=1S/C17H20N4O2S/c1-5-21-14-8-7-12(23-6-2)9-13(14)10(3)15(21)16(22)18-17-20-19-11(4)24-17/h7-9H,5-6H2,1-4H3,(H,18,20,22) |
| InChIKey | WVUHOJXGXCICIZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|