C22H27N3O3 — CID 110504048
5-ethoxy-1-ethyl-3-methyl-N-(3-propoxy-2-pyridinyl)indole-2-carboxamide (PubChem CID 110504048) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 5-ethoxy-1-ethyl-3-methyl-N-(3-propoxy-2-pyridinyl)indole-2-carboxamide.
| Compound Name | 5-ethoxy-1-ethyl-3-methyl-N-(3-propoxy-2-pyridinyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 110504048 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 5-ethoxy-1-ethyl-3-methyl-N-(3-propoxy-2-pyridinyl)indole-2-carboxamide |
| SMILES | CCCOc1cccnc1NC(=O)c1c(C)c2cc(OCC)ccc2n1CC |
| InChI | InChI=1S/C22H27N3O3/c1-5-13-28-19-9-8-12-23-21(19)24-22(26)20-15(4)17-14-16(27-7-3)10-11-18(17)25(20)6-2/h8-12,14H,5-7,13H2,1-4H3,(H,23,24,26) |
| InChIKey | WCFAJUJLHMALNE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|