C18H15Cl3N2O — CID 110502070
5-chloro-N-(3,5-dichlorophenyl)-1-ethyl-3-methylindole-2-carboxamide (PubChem CID 110502070) has the molecular formula C18H15Cl3N2O and a molecular weight of 381.69 g/mol. Its IUPAC name is 5-chloro-N-(3,5-dichlorophenyl)-1-ethyl-3-methylindole-2-carboxamide.
| Compound Name | 5-chloro-N-(3,5-dichlorophenyl)-1-ethyl-3-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 110502070 |
| Molecular Formula | C18H15Cl3N2O |
| Molecular Weight | 381.69 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 5-chloro-N-(3,5-dichlorophenyl)-1-ethyl-3-methylindole-2-carboxamide |
| SMILES | CCn1c(C(=O)Nc2cc(Cl)cc(Cl)c2)c(C)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C18H15Cl3N2O/c1-3-23-16-5-4-11(19)9-15(16)10(2)17(23)18(24)22-14-7-12(20)6-13(21)8-14/h4-9H,3H2,1-2H3,(H,22,24) |
| InChIKey | DUWDUPPUVWYYJE-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.69 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|